Azlocillin

{{Drugbox | verifiedrevid = 458972860 | IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6-{[(2''R'')-2-{[(2-oxoimidazolidin-1-yl)carbonyl]amino}-2-phenylacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | image = Azlocillin skeletal.svg

| tradename = | Drugs.com =

| CAS_number_Ref = | CAS_number = 37091-66-0 | ATC_prefix = J01 | ATC_suffix = CA09 | PubChem = 6479523 | DrugBank_Ref = | DrugBank = DB01061 | ChemSpiderID_Ref = | ChemSpiderID = 4980416 | UNII_Ref = | UNII = HUM6H389W0 | KEGG_Ref = | KEGG = D02339 | ChEBI_Ref = | ChEBI = 2956 | ChEMBL_Ref = | ChEMBL = 1537

| C=20 | H=23 | N=5 | O=6 | S=1 | smiles = O=C(O)[C@@H]3N4C(=O)[C@@H](NC(=O)[C@@H](c1ccccc1)NC(=O)N2C(=O)NCC2)[C@H]4SC3(C)C | StdInChI_Ref = | StdInChI = 1S/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = JTWOMNBEOCYFNV-NFFDBFGFSA-N }}

Azlocillin is an acyl ampicillin antibiotic with an extended spectrum of activity and greater ''in vitro'' potency than the carboxy penicillins. Azlocillin is similar to mezlocillin and piperacillin. It demonstrates antibacterial activity against a broad spectrum of bacteria, including ''Pseudomonas aeruginosa'' and, in contrast to most cephalosporins, exhibits activity against enterococci. Provided by Wikipedia
Showing 1 - 20 results of 26 for search 'Azlin', query time: 0.03s Refine Results
  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20
Search Tools: RSS Feed Email Search